C18H18N6O5 — CID 100909437
ethyl (1R,2S,3R,7R)-3-azido-8-benzoyl-10-methyl-4-oxo-9-oxa-5,6,8-triazatricyclo[5.2.2.02,5]undec-10-ene-6-carboxylate (PubChem CID 100909437) has the molecular formula C18H18N6O5 and a molecular weight of 398.38 g/mol. Its IUPAC name is ethyl (1R,2S,3R,7R)-3-azido-8-benzoyl-10-methyl-4-oxo-9-oxa-5,6,8-triazatricyclo[5.2.2.02,5]undec-10-ene-6-carboxylate.
| Compound Name | ethyl (1R,2S,3R,7R)-3-azido-8-benzoyl-10-methyl-4-oxo-9-oxa-5,6,8-triazatricyclo[5.2.2.02,5]undec-10-ene-6-carboxylate |
|---|---|
| PubChem CID | 100909437 |
| Molecular Formula | C18H18N6O5 |
| Molecular Weight | 398.38 g/mol |
| Exact Mass | 398.13 |
| IUPAC Name | ethyl (1R,2S,3R,7R)-3-azido-8-benzoyl-10-methyl-4-oxo-9-oxa-5,6,8-triazatricyclo[5.2.2.02,5]undec-10-ene-6-carboxylate |
| SMILES | CCOC(=O)N1[C@H]2C=C(C)[C@@H](ON2C(=O)c2ccccc2)[C@@H]2[C@@H](N=[N+]=[N-])C(=O)N21 |
| InChI | InChI=1S/C18H18N6O5/c1-3-28-18(27)22-12-9-10(2)15(14-13(20-21-19)17(26)23(14)22)29-24(12)16(25)11-7-5-4-6-8-11/h4-9,12-15H,3H2,1-2H3/t12-,13-,14+,15-/m1/s1 |
| InChIKey | CNTZDOGWMXCJLB-APIJFGDWSA-N |
| XLogP | 1.99 |
| TPSA | 128.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.38 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|