C19H21N3O5 — CID 11895679
ethyl (1R,2R,3R,7S)-9-benzoyl-3,10-dimethyl-4-oxo-8-oxa-5,6,9-triazatricyclo[5.2.2.02,5]undec-10-ene-6-carboxylate (PubChem CID 11895679) has the molecular formula C19H21N3O5 and a molecular weight of 371.39 g/mol. Its IUPAC name is ethyl (1R,2R,3R,7S)-9-benzoyl-3,10-dimethyl-4-oxo-8-oxa-5,6,9-triazatricyclo[5.2.2.02,5]undec-10-ene-6-carboxylate.
| Compound Name | ethyl (1R,2R,3R,7S)-9-benzoyl-3,10-dimethyl-4-oxo-8-oxa-5,6,9-triazatricyclo[5.2.2.02,5]undec-10-ene-6-carboxylate |
|---|---|
| PubChem CID | 11895679 |
| Molecular Formula | C19H21N3O5 |
| Molecular Weight | 371.39 g/mol |
| Exact Mass | 371.15 |
| IUPAC Name | ethyl (1R,2R,3R,7S)-9-benzoyl-3,10-dimethyl-4-oxo-8-oxa-5,6,9-triazatricyclo[5.2.2.02,5]undec-10-ene-6-carboxylate |
| SMILES | CCOC(=O)N1[C@@H]2C=C(C)[C@H]([C@H]3[C@@H](C)C(=O)N31)N(C(=O)c1ccccc1)O2 |
| InChI | InChI=1S/C19H21N3O5/c1-4-26-19(25)20-14-10-11(2)15(16-12(3)17(23)21(16)20)22(27-14)18(24)13-8-6-5-7-9-13/h5-10,12,14-16H,4H2,1-3H3/t12-,14+,15-,16-/m1/s1 |
| InChIKey | OJTAKJORQOHLEH-SLBVQIDZSA-N |
| XLogP | 1.95 |
| TPSA | 79.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.39 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|