C29H34N4O6Si — CID 129431400
2-trimethylsilylethyl (1R,2R,3S,7R)-8-benzoyl-10-methyl-4-oxo-3-[(2-phenylacetyl)amino]-9-oxa-5,6,8-triazatricyclo[5.2.2.02,5]undec-10-ene-6-carboxylate (PubChem CID 129431400) has the molecular formula C29H34N4O6Si and a molecular weight of 562.70 g/mol. Its IUPAC name is 2-trimethylsilylethyl (1R,2R,3S,7R)-8-benzoyl-10-methyl-4-oxo-3-[(2-phenylacetyl)amino]-9-oxa-5,6,8-triazatricyclo[5.2.2.02,5]undec-10-ene-6-carboxylate.
| Compound Name | 2-trimethylsilylethyl (1R,2R,3S,7R)-8-benzoyl-10-methyl-4-oxo-3-[(2-phenylacetyl)amino]-9-oxa-5,6,8-triazatricyclo[5.2.2.02,5]undec-10-ene-6-carboxylate |
|---|---|
| PubChem CID | 129431400 |
| Molecular Formula | C29H34N4O6Si |
| Molecular Weight | 562.70 g/mol |
| Exact Mass | 562.22 |
| IUPAC Name | 2-trimethylsilylethyl (1R,2R,3S,7R)-8-benzoyl-10-methyl-4-oxo-3-[(2-phenylacetyl)amino]-9-oxa-5,6,8-triazatricyclo[5.2.2.02,5]undec-10-ene-6-carboxylate |
| SMILES | CC1=C[C@H]2N(C(=O)c3ccccc3)O[C@H]1[C@H]1[C@H](NC(=O)Cc3ccccc3)C(=O)N1N2C(=O)OCC[Si](C)(C)C |
| InChI | InChI=1S/C29H34N4O6Si/c1-19-17-23-31(29(37)38-15-16-40(2,3)4)32-25(26(19)39-33(23)27(35)21-13-9-6-10-14-21)24(28(32)36)30-22(34)18-20-11-7-5-8-12-20/h5-14,17,23-26H,15-16,18H2,1-4H3,(H,30,34)/t23-,24+,25-,26-/m1/s1 |
| InChIKey | PQZKWZHMTRQXLZ-XDZVQPMWSA-N |
| XLogP | 3.36 |
| TPSA | 108.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.70 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|