C18H20N2O3 — CID 101332447
N-[(3aR,4R,7aR)-5,7-dimethyl-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-4-yl]-2-phenylacetamide (PubChem CID 101332447) has the molecular formula C18H20N2O3 and a molecular weight of 312.37 g/mol. Its IUPAC name is N-[(3aR,4R,7aR)-5,7-dimethyl-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-4-yl]-2-phenylacetamide.
| Compound Name | N-[(3aR,4R,7aR)-5,7-dimethyl-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-4-yl]-2-phenylacetamide |
|---|---|
| PubChem CID | 101332447 |
| Molecular Formula | C18H20N2O3 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.15 |
| IUPAC Name | N-[(3aR,4R,7aR)-5,7-dimethyl-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-4-yl]-2-phenylacetamide |
| SMILES | CC1=CC(C)[C@H]2C(=O)NC(=O)[C@H]2[C@H]1NC(=O)Cc1ccccc1 |
| InChI | InChI=1S/C18H20N2O3/c1-10-8-11(2)16(15-14(10)17(22)20-18(15)23)19-13(21)9-12-6-4-3-5-7-12/h3-8,10,14-16H,9H2,1-2H3,(H,19,21)(H,20,22,23)/t10?,14-,15-,16+/m1/s1 |
| InChIKey | IKOJDEOMHHHNLN-UNYZIJBGSA-N |
| XLogP | 1.20 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|