C17H15N3O4 — CID 54382038
2-(4-nitrophenyl)-N-(2-oxo-4-phenylazetidin-3-yl)acetamide (PubChem CID 54382038) has the molecular formula C17H15N3O4 and a molecular weight of 325.32 g/mol. Its IUPAC name is 2-(4-nitrophenyl)-N-(2-oxo-4-phenylazetidin-3-yl)acetamide.
| Compound Name | 2-(4-nitrophenyl)-N-(2-oxo-4-phenylazetidin-3-yl)acetamide |
|---|---|
| PubChem CID | 54382038 |
| Molecular Formula | C17H15N3O4 |
| Molecular Weight | 325.32 g/mol |
| Exact Mass | 325.11 |
| IUPAC Name | 2-(4-nitrophenyl)-N-(2-oxo-4-phenylazetidin-3-yl)acetamide |
| SMILES | O=C(Cc1ccc([N+](=O)[O-])cc1)NC1C(=O)NC1c1ccccc1 |
| InChI | InChI=1S/C17H15N3O4/c21-14(10-11-6-8-13(9-7-11)20(23)24)18-16-15(19-17(16)22)12-4-2-1-3-5-12/h1-9,15-16H,10H2,(H,18,21)(H,19,22) |
| InChIKey | VAPDIKYYXXGFAT-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 101.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.32 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|