C13H14N2O2S — CID 40642590
S-[(4S)-4-methyl-6-oxo-4,5-dihydro-1H-pyrimidin-2-yl] 2-phenylethanethioate (PubChem CID 40642590) has the molecular formula C13H14N2O2S and a molecular weight of 262.33 g/mol. Its IUPAC name is S-[(4S)-4-methyl-6-oxo-4,5-dihydro-1H-pyrimidin-2-yl] 2-phenylethanethioate.
| Compound Name | S-[(4S)-4-methyl-6-oxo-4,5-dihydro-1H-pyrimidin-2-yl] 2-phenylethanethioate |
|---|---|
| PubChem CID | 40642590 |
| Molecular Formula | C13H14N2O2S |
| Molecular Weight | 262.33 g/mol |
| Exact Mass | 262.08 |
| IUPAC Name | S-[(4S)-4-methyl-6-oxo-4,5-dihydro-1H-pyrimidin-2-yl] 2-phenylethanethioate |
| SMILES | C[C@H]1CC(=O)NC(SC(=O)Cc2ccccc2)=N1 |
| InChI | InChI=1S/C13H14N2O2S/c1-9-7-11(16)15-13(14-9)18-12(17)8-10-5-3-2-4-6-10/h2-6,9H,7-8H2,1H3,(H,14,15,16)/t9-/m0/s1 |
| InChIKey | FVHLLGVIFKYZRT-VIFPVBQESA-N |
| XLogP | 1.75 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.33 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|