C12H11ClN2O2S — CID 40642523
S-[(4R)-4-methyl-6-oxo-4,5-dihydro-1H-pyrimidin-2-yl] 3-chlorobenzenecarbothioate (PubChem CID 40642523) has the molecular formula C12H11ClN2O2S and a molecular weight of 282.75 g/mol. Its IUPAC name is S-[(4R)-4-methyl-6-oxo-4,5-dihydro-1H-pyrimidin-2-yl] 3-chlorobenzenecarbothioate.
| Compound Name | S-[(4R)-4-methyl-6-oxo-4,5-dihydro-1H-pyrimidin-2-yl] 3-chlorobenzenecarbothioate |
|---|---|
| PubChem CID | 40642523 |
| Molecular Formula | C12H11ClN2O2S |
| Molecular Weight | 282.75 g/mol |
| Exact Mass | 282.02 |
| IUPAC Name | S-[(4R)-4-methyl-6-oxo-4,5-dihydro-1H-pyrimidin-2-yl] 3-chlorobenzenecarbothioate |
| SMILES | C[C@@H]1CC(=O)NC(SC(=O)c2cccc(Cl)c2)=N1 |
| InChI | InChI=1S/C12H11ClN2O2S/c1-7-5-10(16)15-12(14-7)18-11(17)8-3-2-4-9(13)6-8/h2-4,6-7H,5H2,1H3,(H,14,15,16)/t7-/m1/s1 |
| InChIKey | XFMZBTHAVLYYKO-SSDOTTSWSA-N |
| XLogP | 2.48 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.75 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|