C19H18ClN3O4 — CID 92655561
3-chloro-N-[(4R)-4-(2,3-dimethoxyphenyl)-6-oxo-4,5-dihydro-1H-pyrimidin-2-yl]benzamide (PubChem CID 92655561) has the molecular formula C19H18ClN3O4 and a molecular weight of 387.82 g/mol. Its IUPAC name is 3-chloro-N-[(4R)-4-(2,3-dimethoxyphenyl)-6-oxo-4,5-dihydro-1H-pyrimidin-2-yl]benzamide.
| Compound Name | 3-chloro-N-[(4R)-4-(2,3-dimethoxyphenyl)-6-oxo-4,5-dihydro-1H-pyrimidin-2-yl]benzamide |
|---|---|
| PubChem CID | 92655561 |
| Molecular Formula | C19H18ClN3O4 |
| Molecular Weight | 387.82 g/mol |
| Exact Mass | 387.10 |
| IUPAC Name | 3-chloro-N-[(4R)-4-(2,3-dimethoxyphenyl)-6-oxo-4,5-dihydro-1H-pyrimidin-2-yl]benzamide |
| SMILES | COc1cccc([C@H]2CC(=O)NC(NC(=O)c3cccc(Cl)c3)=N2)c1OC |
| InChI | InChI=1S/C19H18ClN3O4/c1-26-15-8-4-7-13(17(15)27-2)14-10-16(24)22-19(21-14)23-18(25)11-5-3-6-12(20)9-11/h3-9,14H,10H2,1-2H3,(H2,21,22,23,24,25)/t14-/m1/s1 |
| InChIKey | HZBBSUPMGRVZGQ-CQSZACIVSA-N |
| XLogP | 2.70 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.82 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het_6_hydropyridone(1)', 'substructure': 'N/A'} |
|---|