C18H14ClN3O4 — CID 20905434
N-[4-(2-chlorophenyl)-6-oxo-4,5-dihydro-1H-pyrimidin-2-yl]-1,3-benzodioxole-5-carboxamide (PubChem CID 20905434) has the molecular formula C18H14ClN3O4 and a molecular weight of 371.78 g/mol. Its IUPAC name is N-[4-(2-chlorophenyl)-6-oxo-4,5-dihydro-1H-pyrimidin-2-yl]-1,3-benzodioxole-5-carboxamide.
| Compound Name | N-[4-(2-chlorophenyl)-6-oxo-4,5-dihydro-1H-pyrimidin-2-yl]-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 20905434 |
| Molecular Formula | C18H14ClN3O4 |
| Molecular Weight | 371.78 g/mol |
| Exact Mass | 371.07 |
| IUPAC Name | N-[4-(2-chlorophenyl)-6-oxo-4,5-dihydro-1H-pyrimidin-2-yl]-1,3-benzodioxole-5-carboxamide |
| SMILES | O=C1CC(c2ccccc2Cl)N=C(NC(=O)c2ccc3c(c2)OCO3)N1 |
| InChI | InChI=1S/C18H14ClN3O4/c19-12-4-2-1-3-11(12)13-8-16(23)21-18(20-13)22-17(24)10-5-6-14-15(7-10)26-9-25-14/h1-7,13H,8-9H2,(H2,20,21,22,23,24) |
| InChIKey | JOICCPDKQIWMAC-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.78 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het_6_hydropyridone(1)', 'substructure': 'N/A'} |
|---|