C13H9ClN2O3 — CID 952845
N-(5-chloro-2-pyridinyl)-1,3-benzodioxole-5-carboxamide (PubChem CID 952845) has the molecular formula C13H9ClN2O3 and a molecular weight of 276.68 g/mol. Its IUPAC name is N-(5-chloro-2-pyridinyl)-1,3-benzodioxole-5-carboxamide.
| Compound Name | N-(5-chloro-2-pyridinyl)-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 952845 |
| Molecular Formula | C13H9ClN2O3 |
| Molecular Weight | 276.68 g/mol |
| Exact Mass | 276.03 |
| IUPAC Name | N-(5-chloro-2-pyridinyl)-1,3-benzodioxole-5-carboxamide |
| SMILES | O=C(Nc1ccc(Cl)cn1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C13H9ClN2O3/c14-9-2-4-12(15-6-9)16-13(17)8-1-3-10-11(5-8)19-7-18-10/h1-6H,7H2,(H,15,16,17) |
| InChIKey | ZVHDMBPXYHAZPZ-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.68 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |