C15H14ClN3O3 — CID 35994682
(2S)-2-(1,3-benzodioxol-5-ylamino)-N-(5-chloro-2-pyridinyl)propanamide (PubChem CID 35994682) has the molecular formula C15H14ClN3O3 and a molecular weight of 319.75 g/mol. Its IUPAC name is (2S)-2-(1,3-benzodioxol-5-ylamino)-N-(5-chloro-2-pyridinyl)propanamide.
| Compound Name | (2S)-2-(1,3-benzodioxol-5-ylamino)-N-(5-chloro-2-pyridinyl)propanamide |
|---|---|
| PubChem CID | 35994682 |
| Molecular Formula | C15H14ClN3O3 |
| Molecular Weight | 319.75 g/mol |
| Exact Mass | 319.07 |
| IUPAC Name | (2S)-2-(1,3-benzodioxol-5-ylamino)-N-(5-chloro-2-pyridinyl)propanamide |
| SMILES | C[C@H](Nc1ccc2c(c1)OCO2)C(=O)Nc1ccc(Cl)cn1 |
| InChI | InChI=1S/C15H14ClN3O3/c1-9(15(20)19-14-5-2-10(16)7-17-14)18-11-3-4-12-13(6-11)22-8-21-12/h2-7,9,18H,8H2,1H3,(H,17,19,20)/t9-/m0/s1 |
| InChIKey | JWPYRVGNOQYUJK-VIFPVBQESA-N |
| XLogP | 2.90 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.75 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|