C19H14ClN3O3 — CID 113033223
N-[5-(2-chloroanilino)-2-pyridinyl]-1,3-benzodioxole-5-carboxamide (PubChem CID 113033223) has the molecular formula C19H14ClN3O3 and a molecular weight of 367.79 g/mol. Its IUPAC name is N-[5-(2-chloroanilino)-2-pyridinyl]-1,3-benzodioxole-5-carboxamide.
| Compound Name | N-[5-(2-chloroanilino)-2-pyridinyl]-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 113033223 |
| Molecular Formula | C19H14ClN3O3 |
| Molecular Weight | 367.79 g/mol |
| Exact Mass | 367.07 |
| IUPAC Name | N-[5-(2-chloroanilino)-2-pyridinyl]-1,3-benzodioxole-5-carboxamide |
| SMILES | O=C(Nc1ccc(Nc2ccccc2Cl)cn1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C19H14ClN3O3/c20-14-3-1-2-4-15(14)22-13-6-8-18(21-10-13)23-19(24)12-5-7-16-17(9-12)26-11-25-16/h1-10,22H,11H2,(H,21,23,24) |
| InChIKey | IIIUIZZORWIDPJ-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.79 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |