C22H21N3O3 — CID 113029836
N-[5-(3-phenylpropylamino)-2-pyridinyl]-1,3-benzodioxole-5-carboxamide (PubChem CID 113029836) has the molecular formula C22H21N3O3 and a molecular weight of 375.43 g/mol. Its IUPAC name is N-[5-(3-phenylpropylamino)-2-pyridinyl]-1,3-benzodioxole-5-carboxamide.
| Compound Name | N-[5-(3-phenylpropylamino)-2-pyridinyl]-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 113029836 |
| Molecular Formula | C22H21N3O3 |
| Molecular Weight | 375.43 g/mol |
| Exact Mass | 375.16 |
| IUPAC Name | N-[5-(3-phenylpropylamino)-2-pyridinyl]-1,3-benzodioxole-5-carboxamide |
| SMILES | O=C(Nc1ccc(NCCCc2ccccc2)cn1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C22H21N3O3/c26-22(17-8-10-19-20(13-17)28-15-27-19)25-21-11-9-18(14-24-21)23-12-4-7-16-5-2-1-3-6-16/h1-3,5-6,8-11,13-14,23H,4,7,12,15H2,(H,24,25,26) |
| InChIKey | AZRXUSWIBILNGW-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.43 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|