C15H10Cl2N2O4 — CID 10291634
N-[(3,4-dichlorophenyl)carbamoyl]-1,3-benzodioxole-5-carboxamide (PubChem CID 10291634) has the molecular formula C15H10Cl2N2O4 and a molecular weight of 353.16 g/mol. Its IUPAC name is N-[(3,4-dichlorophenyl)carbamoyl]-1,3-benzodioxole-5-carboxamide.
| Compound Name | N-[(3,4-dichlorophenyl)carbamoyl]-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 10291634 |
| Molecular Formula | C15H10Cl2N2O4 |
| Molecular Weight | 353.16 g/mol |
| Exact Mass | 352.00 |
| IUPAC Name | N-[(3,4-dichlorophenyl)carbamoyl]-1,3-benzodioxole-5-carboxamide |
| SMILES | O=C(NC(=O)c1ccc2c(c1)OCO2)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C15H10Cl2N2O4/c16-10-3-2-9(6-11(10)17)18-15(21)19-14(20)8-1-4-12-13(5-8)23-7-22-12/h1-6H,7H2,(H2,18,19,20,21) |
| InChIKey | MBTBKQZQTIGPMG-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.16 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |