C13H10N2O4 — CID 110744331
N-(2-oxo-1H-pyridin-3-yl)-1,3-benzodioxole-5-carboxamide (PubChem CID 110744331) has the molecular formula C13H10N2O4 and a molecular weight of 258.23 g/mol. Its IUPAC name is N-(2-oxo-1H-pyridin-3-yl)-1,3-benzodioxole-5-carboxamide.
| Compound Name | N-(2-oxo-1H-pyridin-3-yl)-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 110744331 |
| Molecular Formula | C13H10N2O4 |
| Molecular Weight | 258.23 g/mol |
| Exact Mass | 258.06 |
| IUPAC Name | N-(2-oxo-1H-pyridin-3-yl)-1,3-benzodioxole-5-carboxamide |
| SMILES | O=C(Nc1ccc[nH]c1=O)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C13H10N2O4/c16-12(15-9-2-1-5-14-13(9)17)8-3-4-10-11(6-8)19-7-18-10/h1-6H,7H2,(H,14,17)(H,15,16) |
| InChIKey | WNCBJISWSKLVDQ-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 80.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.23 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |