C21H24N4O4 — CID 20905488
N-[4-(2,5-dimethoxyphenyl)-6-oxo-4,5-dihydro-1H-pyrimidin-2-yl]-3-(dimethylamino)benzamide (PubChem CID 20905488) has the molecular formula C21H24N4O4 and a molecular weight of 396.45 g/mol. Its IUPAC name is N-[4-(2,5-dimethoxyphenyl)-6-oxo-4,5-dihydro-1H-pyrimidin-2-yl]-3-(dimethylamino)benzamide.
| Compound Name | N-[4-(2,5-dimethoxyphenyl)-6-oxo-4,5-dihydro-1H-pyrimidin-2-yl]-3-(dimethylamino)benzamide |
|---|---|
| PubChem CID | 20905488 |
| Molecular Formula | C21H24N4O4 |
| Molecular Weight | 396.45 g/mol |
| Exact Mass | 396.18 |
| IUPAC Name | N-[4-(2,5-dimethoxyphenyl)-6-oxo-4,5-dihydro-1H-pyrimidin-2-yl]-3-(dimethylamino)benzamide |
| SMILES | COc1ccc(OC)c(C2CC(=O)NC(NC(=O)c3cccc(N(C)C)c3)=N2)c1 |
| InChI | InChI=1S/C21H24N4O4/c1-25(2)14-7-5-6-13(10-14)20(27)24-21-22-17(12-19(26)23-21)16-11-15(28-3)8-9-18(16)29-4/h5-11,17H,12H2,1-4H3,(H2,22,23,24,26,27) |
| InChIKey | SERZEKSNCJHAFO-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.45 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het_6_hydropyridone(1)', 'substructure': 'N/A'} |
|---|