C17H17N3O4S — CID 92705426
N-[(4S)-4-(2,5-dimethoxyphenyl)-6-oxo-4,5-dihydro-1H-pyrimidin-2-yl]thiophene-2-carboxamide (PubChem CID 92705426) has the molecular formula C17H17N3O4S and a molecular weight of 359.41 g/mol. Its IUPAC name is N-[(4S)-4-(2,5-dimethoxyphenyl)-6-oxo-4,5-dihydro-1H-pyrimidin-2-yl]thiophene-2-carboxamide.
| Compound Name | N-[(4S)-4-(2,5-dimethoxyphenyl)-6-oxo-4,5-dihydro-1H-pyrimidin-2-yl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 92705426 |
| Molecular Formula | C17H17N3O4S |
| Molecular Weight | 359.41 g/mol |
| Exact Mass | 359.09 |
| IUPAC Name | N-[(4S)-4-(2,5-dimethoxyphenyl)-6-oxo-4,5-dihydro-1H-pyrimidin-2-yl]thiophene-2-carboxamide |
| SMILES | COc1ccc(OC)c([C@@H]2CC(=O)NC(NC(=O)c3cccs3)=N2)c1 |
| InChI | InChI=1S/C17H17N3O4S/c1-23-10-5-6-13(24-2)11(8-10)12-9-15(21)19-17(18-12)20-16(22)14-4-3-7-25-14/h3-8,12H,9H2,1-2H3,(H2,18,19,20,21,22)/t12-/m0/s1 |
| InChIKey | UHCCCHBISAJDHL-LBPRGKRZSA-N |
| XLogP | 2.11 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.41 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het_6_hydropyridone(1)', 'substructure': 'N/A'} |
|---|