C21H23N3O6 — CID 20905465
3-methoxy-N-[6-oxo-4-(2,3,4-trimethoxyphenyl)-4,5-dihydro-1H-pyrimidin-2-yl]benzamide (PubChem CID 20905465) has the molecular formula C21H23N3O6 and a molecular weight of 413.43 g/mol. Its IUPAC name is 3-methoxy-N-[6-oxo-4-(2,3,4-trimethoxyphenyl)-4,5-dihydro-1H-pyrimidin-2-yl]benzamide.
| Compound Name | 3-methoxy-N-[6-oxo-4-(2,3,4-trimethoxyphenyl)-4,5-dihydro-1H-pyrimidin-2-yl]benzamide |
|---|---|
| PubChem CID | 20905465 |
| Molecular Formula | C21H23N3O6 |
| Molecular Weight | 413.43 g/mol |
| Exact Mass | 413.16 |
| IUPAC Name | 3-methoxy-N-[6-oxo-4-(2,3,4-trimethoxyphenyl)-4,5-dihydro-1H-pyrimidin-2-yl]benzamide |
| SMILES | COc1cccc(C(=O)NC2=NC(c3ccc(OC)c(OC)c3OC)CC(=O)N2)c1 |
| InChI | InChI=1S/C21H23N3O6/c1-27-13-7-5-6-12(10-13)20(26)24-21-22-15(11-17(25)23-21)14-8-9-16(28-2)19(30-4)18(14)29-3/h5-10,15H,11H2,1-4H3,(H2,22,23,24,25,26) |
| InChIKey | LXMJZSHRVDGYTF-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 107.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.43 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het_6_hydropyridone(1)', 'substructure': 'N/A'} |
|---|