C18H18N4O3 — CID 92705373
N-[(4R)-4-(2-ethoxyphenyl)-6-oxo-4,5-dihydro-1H-pyrimidin-2-yl]pyridine-3-carboxamide (PubChem CID 92705373) has the molecular formula C18H18N4O3 and a molecular weight of 338.37 g/mol. Its IUPAC name is N-[(4R)-4-(2-ethoxyphenyl)-6-oxo-4,5-dihydro-1H-pyrimidin-2-yl]pyridine-3-carboxamide.
| Compound Name | N-[(4R)-4-(2-ethoxyphenyl)-6-oxo-4,5-dihydro-1H-pyrimidin-2-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 92705373 |
| Molecular Formula | C18H18N4O3 |
| Molecular Weight | 338.37 g/mol |
| Exact Mass | 338.14 |
| IUPAC Name | N-[(4R)-4-(2-ethoxyphenyl)-6-oxo-4,5-dihydro-1H-pyrimidin-2-yl]pyridine-3-carboxamide |
| SMILES | CCOc1ccccc1[C@H]1CC(=O)NC(NC(=O)c2cccnc2)=N1 |
| InChI | InChI=1S/C18H18N4O3/c1-2-25-15-8-4-3-7-13(15)14-10-16(23)21-18(20-14)22-17(24)12-6-5-9-19-11-12/h3-9,11,14H,2,10H2,1H3,(H2,20,21,22,23,24)/t14-/m1/s1 |
| InChIKey | HRFMXZSHLJYSCJ-CQSZACIVSA-N |
| XLogP | 1.83 |
| TPSA | 92.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.37 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het_6_hydropyridone(1)', 'substructure': 'N/A'} |
|---|