C22H21N3O4 — CID 108925024
N-[4-[[2-(2-ethoxyphenoxy)acetyl]amino]phenyl]pyridine-3-carboxamide (PubChem CID 108925024) has the molecular formula C22H21N3O4 and a molecular weight of 391.43 g/mol. Its IUPAC name is N-[4-[[2-(2-ethoxyphenoxy)acetyl]amino]phenyl]pyridine-3-carboxamide.
| Compound Name | N-[4-[[2-(2-ethoxyphenoxy)acetyl]amino]phenyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 108925024 |
| Molecular Formula | C22H21N3O4 |
| Molecular Weight | 391.43 g/mol |
| Exact Mass | 391.15 |
| IUPAC Name | N-[4-[[2-(2-ethoxyphenoxy)acetyl]amino]phenyl]pyridine-3-carboxamide |
| SMILES | CCOc1ccccc1OCC(=O)Nc1ccc(NC(=O)c2cccnc2)cc1 |
| InChI | InChI=1S/C22H21N3O4/c1-2-28-19-7-3-4-8-20(19)29-15-21(26)24-17-9-11-18(12-10-17)25-22(27)16-6-5-13-23-14-16/h3-14H,2,15H2,1H3,(H,24,26)(H,25,27) |
| InChIKey | VNUORLQQORAQTO-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 89.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.43 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |