C14H14N4O2 — CID 43812722
N-[6-(propanoylamino)-3-pyridinyl]pyridine-3-carboxamide (PubChem CID 43812722) has the molecular formula C14H14N4O2 and a molecular weight of 270.29 g/mol. Its IUPAC name is N-[6-(propanoylamino)-3-pyridinyl]pyridine-3-carboxamide.
| Compound Name | N-[6-(propanoylamino)-3-pyridinyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 43812722 |
| Molecular Formula | C14H14N4O2 |
| Molecular Weight | 270.29 g/mol |
| Exact Mass | 270.11 |
| IUPAC Name | N-[6-(propanoylamino)-3-pyridinyl]pyridine-3-carboxamide |
| SMILES | CCC(=O)Nc1ccc(NC(=O)c2cccnc2)cn1 |
| InChI | InChI=1S/C14H14N4O2/c1-2-13(19)18-12-6-5-11(9-16-12)17-14(20)10-4-3-7-15-8-10/h3-9H,2H2,1H3,(H,17,20)(H,16,18,19) |
| InChIKey | AYFXUKNDJKIFNP-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.29 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |