C25H24N2O6 — CID 108927830
[3-[[3-[[2-(2-ethoxyphenoxy)acetyl]amino]phenyl]carbamoyl]phenyl] acetate (PubChem CID 108927830) has the molecular formula C25H24N2O6 and a molecular weight of 448.48 g/mol. Its IUPAC name is [3-[[3-[[2-(2-ethoxyphenoxy)acetyl]amino]phenyl]carbamoyl]phenyl] acetate.
| Compound Name | [3-[[3-[[2-(2-ethoxyphenoxy)acetyl]amino]phenyl]carbamoyl]phenyl] acetate |
|---|---|
| PubChem CID | 108927830 |
| Molecular Formula | C25H24N2O6 |
| Molecular Weight | 448.48 g/mol |
| Exact Mass | 448.16 |
| IUPAC Name | [3-[[3-[[2-(2-ethoxyphenoxy)acetyl]amino]phenyl]carbamoyl]phenyl] acetate |
| SMILES | CCOc1ccccc1OCC(=O)Nc1cccc(NC(=O)c2cccc(OC(C)=O)c2)c1 |
| InChI | InChI=1S/C25H24N2O6/c1-3-31-22-12-4-5-13-23(22)32-16-24(29)26-19-9-7-10-20(15-19)27-25(30)18-8-6-11-21(14-18)33-17(2)28/h4-15H,3,16H2,1-2H3,(H,26,29)(H,27,30) |
| InChIKey | GAGGLTSGQPJTBZ-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.48 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|