C26H26N2O6 — CID 108929044
[3-[[3-[[2-(2-ethoxyphenoxy)acetyl]amino]phenyl]methylcarbamoyl]phenyl] acetate (PubChem CID 108929044) has the molecular formula C26H26N2O6 and a molecular weight of 462.50 g/mol. Its IUPAC name is [3-[[3-[[2-(2-ethoxyphenoxy)acetyl]amino]phenyl]methylcarbamoyl]phenyl] acetate.
| Compound Name | [3-[[3-[[2-(2-ethoxyphenoxy)acetyl]amino]phenyl]methylcarbamoyl]phenyl] acetate |
|---|---|
| PubChem CID | 108929044 |
| Molecular Formula | C26H26N2O6 |
| Molecular Weight | 462.50 g/mol |
| Exact Mass | 462.18 |
| IUPAC Name | [3-[[3-[[2-(2-ethoxyphenoxy)acetyl]amino]phenyl]methylcarbamoyl]phenyl] acetate |
| SMILES | CCOc1ccccc1OCC(=O)Nc1cccc(CNC(=O)c2cccc(OC(C)=O)c2)c1 |
| InChI | InChI=1S/C26H26N2O6/c1-3-32-23-12-4-5-13-24(23)33-17-25(30)28-21-10-6-8-19(14-21)16-27-26(31)20-9-7-11-22(15-20)34-18(2)29/h4-15H,3,16-17H2,1-2H3,(H,27,31)(H,28,30) |
| InChIKey | USZPFBHSFPOFKS-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.50 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|