C28H32N2O4 — CID 108928998
[3-[[3-[[2-(1-adamantyl)acetyl]amino]phenyl]methylcarbamoyl]phenyl] acetate (PubChem CID 108928998) has the molecular formula C28H32N2O4 and a molecular weight of 460.57 g/mol. Its IUPAC name is [3-[[3-[[2-(1-adamantyl)acetyl]amino]phenyl]methylcarbamoyl]phenyl] acetate.
| Compound Name | [3-[[3-[[2-(1-adamantyl)acetyl]amino]phenyl]methylcarbamoyl]phenyl] acetate |
|---|---|
| PubChem CID | 108928998 |
| Molecular Formula | C28H32N2O4 |
| Molecular Weight | 460.57 g/mol |
| Exact Mass | 460.24 |
| IUPAC Name | [3-[[3-[[2-(1-adamantyl)acetyl]amino]phenyl]methylcarbamoyl]phenyl] acetate |
| SMILES | CC(=O)Oc1cccc(C(=O)NCc2cccc(NC(=O)CC34CC5CC(CC(C5)C3)C4)c2)c1 |
| InChI | InChI=1S/C28H32N2O4/c1-18(31)34-25-7-3-5-23(12-25)27(33)29-17-19-4-2-6-24(11-19)30-26(32)16-28-13-20-8-21(14-28)10-22(9-20)15-28/h2-7,11-12,20-22H,8-10,13-17H2,1H3,(H,29,33)(H,30,32) |
| InChIKey | PKGIDKZRTDUVGE-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.57 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|