C23H26N2O5 — CID 108929308
[3-[[3-[[2-(oxan-4-yl)acetyl]amino]phenyl]methylcarbamoyl]phenyl] acetate (PubChem CID 108929308) has the molecular formula C23H26N2O5 and a molecular weight of 410.47 g/mol. Its IUPAC name is [3-[[3-[[2-(oxan-4-yl)acetyl]amino]phenyl]methylcarbamoyl]phenyl] acetate.
| Compound Name | [3-[[3-[[2-(oxan-4-yl)acetyl]amino]phenyl]methylcarbamoyl]phenyl] acetate |
|---|---|
| PubChem CID | 108929308 |
| Molecular Formula | C23H26N2O5 |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.18 |
| IUPAC Name | [3-[[3-[[2-(oxan-4-yl)acetyl]amino]phenyl]methylcarbamoyl]phenyl] acetate |
| SMILES | CC(=O)Oc1cccc(C(=O)NCc2cccc(NC(=O)CC3CCOCC3)c2)c1 |
| InChI | InChI=1S/C23H26N2O5/c1-16(26)30-21-7-3-5-19(14-21)23(28)24-15-18-4-2-6-20(12-18)25-22(27)13-17-8-10-29-11-9-17/h2-7,12,14,17H,8-11,13,15H2,1H3,(H,24,28)(H,25,27) |
| InChIKey | OZEXXSJCVIDSGW-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|