C29H32N2O5 — CID 108929047
[3-[[3-[[[2-(2-tert-butyl-4-methylphenoxy)acetyl]amino]methyl]phenyl]carbamoyl]phenyl] acetate (PubChem CID 108929047) has the molecular formula C29H32N2O5 and a molecular weight of 488.58 g/mol. Its IUPAC name is [3-[[3-[[[2-(2-tert-butyl-4-methylphenoxy)acetyl]amino]methyl]phenyl]carbamoyl]phenyl] acetate.
| Compound Name | [3-[[3-[[[2-(2-tert-butyl-4-methylphenoxy)acetyl]amino]methyl]phenyl]carbamoyl]phenyl] acetate |
|---|---|
| PubChem CID | 108929047 |
| Molecular Formula | C29H32N2O5 |
| Molecular Weight | 488.58 g/mol |
| Exact Mass | 488.23 |
| IUPAC Name | [3-[[3-[[[2-(2-tert-butyl-4-methylphenoxy)acetyl]amino]methyl]phenyl]carbamoyl]phenyl] acetate |
| SMILES | CC(=O)Oc1cccc(C(=O)Nc2cccc(CNC(=O)COc3ccc(C)cc3C(C)(C)C)c2)c1 |
| InChI | InChI=1S/C29H32N2O5/c1-19-12-13-26(25(14-19)29(3,4)5)35-18-27(33)30-17-21-8-6-10-23(15-21)31-28(34)22-9-7-11-24(16-22)36-20(2)32/h6-16H,17-18H2,1-5H3,(H,30,33)(H,31,34) |
| InChIKey | MAPCBIGBMQAQEG-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.58 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|