C26H25ClN2O5 — CID 108928275
[3-[[4-[[[2-(4-chloro-3,5-dimethylphenoxy)acetyl]amino]methyl]phenyl]carbamoyl]phenyl] acetate (PubChem CID 108928275) has the molecular formula C26H25ClN2O5 and a molecular weight of 480.95 g/mol. Its IUPAC name is [3-[[4-[[[2-(4-chloro-3,5-dimethylphenoxy)acetyl]amino]methyl]phenyl]carbamoyl]phenyl] acetate.
| Compound Name | [3-[[4-[[[2-(4-chloro-3,5-dimethylphenoxy)acetyl]amino]methyl]phenyl]carbamoyl]phenyl] acetate |
|---|---|
| PubChem CID | 108928275 |
| Molecular Formula | C26H25ClN2O5 |
| Molecular Weight | 480.95 g/mol |
| Exact Mass | 480.15 |
| IUPAC Name | [3-[[4-[[[2-(4-chloro-3,5-dimethylphenoxy)acetyl]amino]methyl]phenyl]carbamoyl]phenyl] acetate |
| SMILES | CC(=O)Oc1cccc(C(=O)Nc2ccc(CNC(=O)COc3cc(C)c(Cl)c(C)c3)cc2)c1 |
| InChI | InChI=1S/C26H25ClN2O5/c1-16-11-23(12-17(2)25(16)27)33-15-24(31)28-14-19-7-9-21(10-8-19)29-26(32)20-5-4-6-22(13-20)34-18(3)30/h4-13H,14-15H2,1-3H3,(H,28,31)(H,29,32) |
| InChIKey | NOKYUGAFLCUONU-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.95 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|