C24H21ClN2O5 — CID 108928317
[3-[[4-[[[2-(4-chlorophenoxy)acetyl]amino]methyl]phenyl]carbamoyl]phenyl] acetate (PubChem CID 108928317) has the molecular formula C24H21ClN2O5 and a molecular weight of 452.89 g/mol. Its IUPAC name is [3-[[4-[[[2-(4-chlorophenoxy)acetyl]amino]methyl]phenyl]carbamoyl]phenyl] acetate.
| Compound Name | [3-[[4-[[[2-(4-chlorophenoxy)acetyl]amino]methyl]phenyl]carbamoyl]phenyl] acetate |
|---|---|
| PubChem CID | 108928317 |
| Molecular Formula | C24H21ClN2O5 |
| Molecular Weight | 452.89 g/mol |
| Exact Mass | 452.11 |
| IUPAC Name | [3-[[4-[[[2-(4-chlorophenoxy)acetyl]amino]methyl]phenyl]carbamoyl]phenyl] acetate |
| SMILES | CC(=O)Oc1cccc(C(=O)Nc2ccc(CNC(=O)COc3ccc(Cl)cc3)cc2)c1 |
| InChI | InChI=1S/C24H21ClN2O5/c1-16(28)32-22-4-2-3-18(13-22)24(30)27-20-9-5-17(6-10-20)14-26-23(29)15-31-21-11-7-19(25)8-12-21/h2-13H,14-15H2,1H3,(H,26,29)(H,27,30) |
| InChIKey | JCZLQJQHLMCHMY-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.89 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|