C27H24N2O4 — CID 11841398
N-(2-ethoxyphenyl)-3-[(2-naphthalen-1-yloxyacetyl)amino]benzamide (PubChem CID 11841398) has the molecular formula C27H24N2O4 and a molecular weight of 440.50 g/mol. Its IUPAC name is N-(2-ethoxyphenyl)-3-[(2-naphthalen-1-yloxyacetyl)amino]benzamide.
| Compound Name | N-(2-ethoxyphenyl)-3-[(2-naphthalen-1-yloxyacetyl)amino]benzamide |
|---|---|
| PubChem CID | 11841398 |
| Molecular Formula | C27H24N2O4 |
| Molecular Weight | 440.50 g/mol |
| Exact Mass | 440.17 |
| IUPAC Name | N-(2-ethoxyphenyl)-3-[(2-naphthalen-1-yloxyacetyl)amino]benzamide |
| SMILES | CCOc1ccccc1NC(=O)c1cccc(NC(=O)COc2cccc3ccccc23)c1 |
| InChI | InChI=1S/C27H24N2O4/c1-2-32-25-15-6-5-14-23(25)29-27(31)20-11-7-12-21(17-20)28-26(30)18-33-24-16-8-10-19-9-3-4-13-22(19)24/h3-17H,2,18H2,1H3,(H,28,30)(H,29,31) |
| InChIKey | ZSQKLKREQVWAEF-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.50 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |