C20H20ClN3O4 — CID 92705406
3-chloro-N-[(4S)-4-(4-ethoxy-3-methoxyphenyl)-6-oxo-4,5-dihydro-1H-pyrimidin-2-yl]benzamide (PubChem CID 92705406) has the molecular formula C20H20ClN3O4 and a molecular weight of 401.85 g/mol. Its IUPAC name is 3-chloro-N-[(4S)-4-(4-ethoxy-3-methoxyphenyl)-6-oxo-4,5-dihydro-1H-pyrimidin-2-yl]benzamide.
| Compound Name | 3-chloro-N-[(4S)-4-(4-ethoxy-3-methoxyphenyl)-6-oxo-4,5-dihydro-1H-pyrimidin-2-yl]benzamide |
|---|---|
| PubChem CID | 92705406 |
| Molecular Formula | C20H20ClN3O4 |
| Molecular Weight | 401.85 g/mol |
| Exact Mass | 401.11 |
| IUPAC Name | 3-chloro-N-[(4S)-4-(4-ethoxy-3-methoxyphenyl)-6-oxo-4,5-dihydro-1H-pyrimidin-2-yl]benzamide |
| SMILES | CCOc1ccc([C@@H]2CC(=O)NC(NC(=O)c3cccc(Cl)c3)=N2)cc1OC |
| InChI | InChI=1S/C20H20ClN3O4/c1-3-28-16-8-7-12(10-17(16)27-2)15-11-18(25)23-20(22-15)24-19(26)13-5-4-6-14(21)9-13/h4-10,15H,3,11H2,1-2H3,(H2,22,23,24,25,26)/t15-/m0/s1 |
| InChIKey | NQIBTDLXDOKRNM-HNNXBMFYSA-N |
| XLogP | 3.09 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.85 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het_6_hydropyridone(1)', 'substructure': 'N/A'} |
|---|