C12H12N4O3 — CID 92857079
[(4R)-4-(2-hydroxy-4-methoxyphenyl)-6-oxo-4,5-dihydro-1H-pyrimidin-2-yl]cyanamide (PubChem CID 92857079) has the molecular formula C12H12N4O3 and a molecular weight of 260.25 g/mol. Its IUPAC name is [(4R)-4-(2-hydroxy-4-methoxyphenyl)-6-oxo-4,5-dihydro-1H-pyrimidin-2-yl]cyanamide.
| Compound Name | [(4R)-4-(2-hydroxy-4-methoxyphenyl)-6-oxo-4,5-dihydro-1H-pyrimidin-2-yl]cyanamide |
|---|---|
| PubChem CID | 92857079 |
| Molecular Formula | C12H12N4O3 |
| Molecular Weight | 260.25 g/mol |
| Exact Mass | 260.09 |
| IUPAC Name | [(4R)-4-(2-hydroxy-4-methoxyphenyl)-6-oxo-4,5-dihydro-1H-pyrimidin-2-yl]cyanamide |
| SMILES | COc1ccc([C@H]2CC(=O)NC(NC#N)=N2)c(O)c1 |
| InChI | InChI=1S/C12H12N4O3/c1-19-7-2-3-8(10(17)4-7)9-5-11(18)16-12(15-9)14-6-13/h2-4,9,17H,5H2,1H3,(H2,14,15,16,18)/t9-/m1/s1 |
| InChIKey | NHQXUEHTYNWEQF-SECBINFHSA-N |
| XLogP | 0.39 |
| TPSA | 106.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.25 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'het_6_hydropyridone(1)', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|