C14H18ClNOS — CID 95972451
3-chloro-N-[(1R,2R)-2-ethylsulfanylcyclopentyl]benzamide (PubChem CID 95972451) has the molecular formula C14H18ClNOS and a molecular weight of 283.82 g/mol. Its IUPAC name is 3-chloro-N-[(1R,2R)-2-ethylsulfanylcyclopentyl]benzamide.
| Compound Name | 3-chloro-N-[(1R,2R)-2-ethylsulfanylcyclopentyl]benzamide |
|---|---|
| PubChem CID | 95972451 |
| Molecular Formula | C14H18ClNOS |
| Molecular Weight | 283.82 g/mol |
| Exact Mass | 283.08 |
| IUPAC Name | 3-chloro-N-[(1R,2R)-2-ethylsulfanylcyclopentyl]benzamide |
| SMILES | CCS[C@@H]1CCC[C@H]1NC(=O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C14H18ClNOS/c1-2-18-13-8-4-7-12(13)16-14(17)10-5-3-6-11(15)9-10/h3,5-6,9,12-13H,2,4,7-8H2,1H3,(H,16,17)/t12-,13-/m1/s1 |
| InChIKey | PFFFREGSLOBSEH-CHWSQXEVSA-N |
| XLogP | 3.74 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.82 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |