C14H19NO3S — CID 103892654
N-(2-ethylsulfanylcyclopentyl)-3,5-dihydroxybenzamide (PubChem CID 103892654) has the molecular formula C14H19NO3S and a molecular weight of 281.38 g/mol. Its IUPAC name is N-(2-ethylsulfanylcyclopentyl)-3,5-dihydroxybenzamide.
| Compound Name | N-(2-ethylsulfanylcyclopentyl)-3,5-dihydroxybenzamide |
|---|---|
| PubChem CID | 103892654 |
| Molecular Formula | C14H19NO3S |
| Molecular Weight | 281.38 g/mol |
| Exact Mass | 281.11 |
| IUPAC Name | N-(2-ethylsulfanylcyclopentyl)-3,5-dihydroxybenzamide |
| SMILES | CCSC1CCCC1NC(=O)c1cc(O)cc(O)c1 |
| InChI | InChI=1S/C14H19NO3S/c1-2-19-13-5-3-4-12(13)15-14(18)9-6-10(16)8-11(17)7-9/h6-8,12-13,16-17H,2-5H2,1H3,(H,15,18) |
| InChIKey | WJDSKYFBOMPSNP-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.38 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |