C15H18N2OS — CID 103727544
4-cyano-N-(2-ethylsulfanylcyclopentyl)benzamide (PubChem CID 103727544) has the molecular formula C15H18N2OS and a molecular weight of 274.39 g/mol. Its IUPAC name is 4-cyano-N-(2-ethylsulfanylcyclopentyl)benzamide.
| Compound Name | 4-cyano-N-(2-ethylsulfanylcyclopentyl)benzamide |
|---|---|
| PubChem CID | 103727544 |
| Molecular Formula | C15H18N2OS |
| Molecular Weight | 274.39 g/mol |
| Exact Mass | 274.11 |
| IUPAC Name | 4-cyano-N-(2-ethylsulfanylcyclopentyl)benzamide |
| SMILES | CCSC1CCCC1NC(=O)c1ccc(C#N)cc1 |
| InChI | InChI=1S/C15H18N2OS/c1-2-19-14-5-3-4-13(14)17-15(18)12-8-6-11(10-16)7-9-12/h6-9,13-14H,2-5H2,1H3,(H,17,18) |
| InChIKey | FTOABRAPTQFONQ-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.39 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |