C14H17F2NOS — CID 103727628
N-(2-ethylsulfanylcyclopentyl)-2,3-difluorobenzamide (PubChem CID 103727628) has the molecular formula C14H17F2NOS and a molecular weight of 285.36 g/mol. Its IUPAC name is N-(2-ethylsulfanylcyclopentyl)-2,3-difluorobenzamide.
| Compound Name | N-(2-ethylsulfanylcyclopentyl)-2,3-difluorobenzamide |
|---|---|
| PubChem CID | 103727628 |
| Molecular Formula | C14H17F2NOS |
| Molecular Weight | 285.36 g/mol |
| Exact Mass | 285.10 |
| IUPAC Name | N-(2-ethylsulfanylcyclopentyl)-2,3-difluorobenzamide |
| SMILES | CCSC1CCCC1NC(=O)c1cccc(F)c1F |
| InChI | InChI=1S/C14H17F2NOS/c1-2-19-12-8-4-7-11(12)17-14(18)9-5-3-6-10(15)13(9)16/h3,5-6,11-12H,2,4,7-8H2,1H3,(H,17,18) |
| InChIKey | ZFZDBGLSUKZTTB-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.36 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |