C16H16N4O5 — CID 56975360
2-diazo-3-oxo-5-[(2R,3S)-4-oxo-3-[(2-phenylacetyl)amino]azetidin-2-yl]pentanoic acid (PubChem CID 56975360) has the molecular formula C16H16N4O5 and a molecular weight of 344.33 g/mol. Its IUPAC name is 2-diazo-3-oxo-5-[(2R,3S)-4-oxo-3-[(2-phenylacetyl)amino]azetidin-2-yl]pentanoic acid.
| Compound Name | 2-diazo-3-oxo-5-[(2R,3S)-4-oxo-3-[(2-phenylacetyl)amino]azetidin-2-yl]pentanoic acid |
|---|---|
| PubChem CID | 56975360 |
| Molecular Formula | C16H16N4O5 |
| Molecular Weight | 344.33 g/mol |
| Exact Mass | 344.11 |
| IUPAC Name | 2-diazo-3-oxo-5-[(2R,3S)-4-oxo-3-[(2-phenylacetyl)amino]azetidin-2-yl]pentanoic acid |
| SMILES | [N-]=[N+]=C(C(=O)O)C(=O)CC[C@H]1NC(=O)[C@H]1NC(=O)Cc1ccccc1 |
| InChI | InChI=1S/C16H16N4O5/c17-20-14(16(24)25)11(21)7-6-10-13(15(23)18-10)19-12(22)8-9-4-2-1-3-5-9/h1-5,10,13H,6-8H2,(H,18,23)(H,19,22)(H,24,25)/t10-,13+/m1/s1 |
| InChIKey | POUWYQNBPGWXHS-MFKMUULPSA-N |
| XLogP | -0.68 |
| TPSA | 148.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.33 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|