C24H24N4O6 — CID 86755102
(4-methoxyphenyl)methyl 2-diazo-3-oxo-5-[4-oxo-3-[(2-phenylacetyl)amino]azetidin-2-yl]pentanoate (PubChem CID 86755102) has the molecular formula C24H24N4O6 and a molecular weight of 464.48 g/mol. Its IUPAC name is (4-methoxyphenyl)methyl 2-diazo-3-oxo-5-[4-oxo-3-[(2-phenylacetyl)amino]azetidin-2-yl]pentanoate.
| Compound Name | (4-methoxyphenyl)methyl 2-diazo-3-oxo-5-[4-oxo-3-[(2-phenylacetyl)amino]azetidin-2-yl]pentanoate |
|---|---|
| PubChem CID | 86755102 |
| Molecular Formula | C24H24N4O6 |
| Molecular Weight | 464.48 g/mol |
| Exact Mass | 464.17 |
| IUPAC Name | (4-methoxyphenyl)methyl 2-diazo-3-oxo-5-[4-oxo-3-[(2-phenylacetyl)amino]azetidin-2-yl]pentanoate |
| SMILES | COc1ccc(COC(=O)C(=[N+]=[N-])C(=O)CCC2NC(=O)C2NC(=O)Cc2ccccc2)cc1 |
| InChI | InChI=1S/C24H24N4O6/c1-33-17-9-7-16(8-10-17)14-34-24(32)22(28-25)19(29)12-11-18-21(23(31)26-18)27-20(30)13-15-5-3-2-4-6-15/h2-10,18,21H,11-14H2,1H3,(H,26,31)(H,27,30) |
| InChIKey | YUHVDPDKLWQTBD-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 147.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.48 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|