C27H26N4O6S2 — CID 23346396
N-[2-[2,2-bis[(2-nitrophenyl)methylsulfanyl]ethyl]-4-oxoazetidin-3-yl]-2-phenylacetamide (PubChem CID 23346396) has the molecular formula C27H26N4O6S2 and a molecular weight of 566.66 g/mol. Its IUPAC name is N-[2-[2,2-bis[(2-nitrophenyl)methylsulfanyl]ethyl]-4-oxoazetidin-3-yl]-2-phenylacetamide.
| Compound Name | N-[2-[2,2-bis[(2-nitrophenyl)methylsulfanyl]ethyl]-4-oxoazetidin-3-yl]-2-phenylacetamide |
|---|---|
| PubChem CID | 23346396 |
| Molecular Formula | C27H26N4O6S2 |
| Molecular Weight | 566.66 g/mol |
| Exact Mass | 566.13 |
| IUPAC Name | N-[2-[2,2-bis[(2-nitrophenyl)methylsulfanyl]ethyl]-4-oxoazetidin-3-yl]-2-phenylacetamide |
| SMILES | O=C(Cc1ccccc1)NC1C(=O)NC1CC(SCc1ccccc1[N+](=O)[O-])SCc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C27H26N4O6S2/c32-24(14-18-8-2-1-3-9-18)29-26-21(28-27(26)33)15-25(38-16-19-10-4-6-12-22(19)30(34)35)39-17-20-11-5-7-13-23(20)31(36)37/h1-13,21,25-26H,14-17H2,(H,28,33)(H,29,32) |
| InChIKey | QJUPCVVOQYCDRX-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 144.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.66 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|