C29H28N4O10S2 — CID 22821372
1-[(2S,3S)-2-[2,2-bis[(2-nitrophenyl)methylsulfanyl]ethyl]-4-oxoazetidin-3-yl]ethyl 2-(4-nitrophenyl)ethaneperoxoate (PubChem CID 22821372) has the molecular formula C29H28N4O10S2 and a molecular weight of 656.70 g/mol. Its IUPAC name is 1-[(2S,3S)-2-[2,2-bis[(2-nitrophenyl)methylsulfanyl]ethyl]-4-oxoazetidin-3-yl]ethyl 2-(4-nitrophenyl)ethaneperoxoate.
| Compound Name | 1-[(2S,3S)-2-[2,2-bis[(2-nitrophenyl)methylsulfanyl]ethyl]-4-oxoazetidin-3-yl]ethyl 2-(4-nitrophenyl)ethaneperoxoate |
|---|---|
| PubChem CID | 22821372 |
| Molecular Formula | C29H28N4O10S2 |
| Molecular Weight | 656.70 g/mol |
| Exact Mass | 656.12 |
| IUPAC Name | 1-[(2S,3S)-2-[2,2-bis[(2-nitrophenyl)methylsulfanyl]ethyl]-4-oxoazetidin-3-yl]ethyl 2-(4-nitrophenyl)ethaneperoxoate |
| SMILES | CC(OOC(=O)Cc1ccc([N+](=O)[O-])cc1)[C@H]1C(=O)N[C@H]1CC(SCc1ccccc1[N+](=O)[O-])SCc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C29H28N4O10S2/c1-18(42-43-26(34)14-19-10-12-22(13-11-19)31(36)37)28-23(30-29(28)35)15-27(44-16-20-6-2-4-8-24(20)32(38)39)45-17-21-7-3-5-9-25(21)33(40)41/h2-13,18,23,27-28H,14-17H2,1H3,(H,30,35)/t18?,23-,28+/m0/s1 |
| InChIKey | ZECITAUMBNHZQR-KBKJAHPRSA-N |
| XLogP | 5.51 |
| TPSA | 194.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.70 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|