C16H20N2O7 — CID 70587515
3-[2,2-dihydroxy-4-(4-nitrophenyl)-3-oxobutyl]-4-(2-hydroxypropyl)azetidin-2-one (PubChem CID 70587515) has the molecular formula C16H20N2O7 and a molecular weight of 352.34 g/mol. Its IUPAC name is 3-[2,2-dihydroxy-4-(4-nitrophenyl)-3-oxobutyl]-4-(2-hydroxypropyl)azetidin-2-one.
| Compound Name | 3-[2,2-dihydroxy-4-(4-nitrophenyl)-3-oxobutyl]-4-(2-hydroxypropyl)azetidin-2-one |
|---|---|
| PubChem CID | 70587515 |
| Molecular Formula | C16H20N2O7 |
| Molecular Weight | 352.34 g/mol |
| Exact Mass | 352.13 |
| IUPAC Name | 3-[2,2-dihydroxy-4-(4-nitrophenyl)-3-oxobutyl]-4-(2-hydroxypropyl)azetidin-2-one |
| SMILES | CC(O)CC1NC(=O)C1CC(O)(O)C(=O)Cc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C16H20N2O7/c1-9(19)6-13-12(15(21)17-13)8-16(22,23)14(20)7-10-2-4-11(5-3-10)18(24)25/h2-5,9,12-13,19,22-23H,6-8H2,1H3,(H,17,21) |
| InChIKey | RTFCFFAWDBPDDT-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 150.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.34 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|