C27H31BrN4O10S — CID 22821370
1-[(2S,3S)-2-[1-bromo-2-[2-methyl-1-[(4-nitrophenyl)methoxycarbonylamino]propan-2-yl]sulfanylethyl]-4-oxoazetidin-3-yl]ethyl 2-(4-nitrophenyl)ethaneperoxoate (PubChem CID 22821370) has the molecular formula C27H31BrN4O10S and a molecular weight of 683.53 g/mol. Its IUPAC name is 1-[(2S,3S)-2-[1-bromo-2-[2-methyl-1-[(4-nitrophenyl)methoxycarbonylamino]propan-2-yl]sulfanylethyl]-4-oxoazetidin-3-yl]ethyl 2-(4-nitrophenyl)ethaneperoxoate.
| Compound Name | 1-[(2S,3S)-2-[1-bromo-2-[2-methyl-1-[(4-nitrophenyl)methoxycarbonylamino]propan-2-yl]sulfanylethyl]-4-oxoazetidin-3-yl]ethyl 2-(4-nitrophenyl)ethaneperoxoate |
|---|---|
| PubChem CID | 22821370 |
| Molecular Formula | C27H31BrN4O10S |
| Molecular Weight | 683.53 g/mol |
| Exact Mass | 682.09 |
| IUPAC Name | 1-[(2S,3S)-2-[1-bromo-2-[2-methyl-1-[(4-nitrophenyl)methoxycarbonylamino]propan-2-yl]sulfanylethyl]-4-oxoazetidin-3-yl]ethyl 2-(4-nitrophenyl)ethaneperoxoate |
| SMILES | CC(OOC(=O)Cc1ccc([N+](=O)[O-])cc1)[C@H]1C(=O)N[C@@H]1C(Br)CSC(C)(C)CNC(=O)OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C27H31BrN4O10S/c1-16(41-42-22(33)12-17-4-8-19(9-5-17)31(36)37)23-24(30-25(23)34)21(28)14-43-27(2,3)15-29-26(35)40-13-18-6-10-20(11-7-18)32(38)39/h4-11,16,21,23-24H,12-15H2,1-3H3,(H,29,35)(H,30,34)/t16?,21?,23-,24-/m1/s1 |
| InChIKey | JLNIAPNESXOYNQ-BSORRLQTSA-N |
| XLogP | 4.23 |
| TPSA | 189.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.53 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|