C25H34N2O9 — CID 22812997
1-[(2R,3S)-1-(oxan-2-yl)-2-[2-(oxan-2-yloxy)ethyl]-4-oxoazetidin-3-yl]ethyl 2-(4-nitrophenyl)ethaneperoxoate (PubChem CID 22812997) has the molecular formula C25H34N2O9 and a molecular weight of 506.55 g/mol. Its IUPAC name is 1-[(2R,3S)-1-(oxan-2-yl)-2-[2-(oxan-2-yloxy)ethyl]-4-oxoazetidin-3-yl]ethyl 2-(4-nitrophenyl)ethaneperoxoate.
| Compound Name | 1-[(2R,3S)-1-(oxan-2-yl)-2-[2-(oxan-2-yloxy)ethyl]-4-oxoazetidin-3-yl]ethyl 2-(4-nitrophenyl)ethaneperoxoate |
|---|---|
| PubChem CID | 22812997 |
| Molecular Formula | C25H34N2O9 |
| Molecular Weight | 506.55 g/mol |
| Exact Mass | 506.23 |
| IUPAC Name | 1-[(2R,3S)-1-(oxan-2-yl)-2-[2-(oxan-2-yloxy)ethyl]-4-oxoazetidin-3-yl]ethyl 2-(4-nitrophenyl)ethaneperoxoate |
| SMILES | CC(OOC(=O)Cc1ccc([N+](=O)[O-])cc1)[C@H]1C(=O)N(C2CCCCO2)[C@@H]1CCOC1CCCCO1 |
| InChI | InChI=1S/C25H34N2O9/c1-17(35-36-22(28)16-18-8-10-19(11-9-18)27(30)31)24-20(12-15-34-23-7-3-5-14-33-23)26(25(24)29)21-6-2-4-13-32-21/h8-11,17,20-21,23-24H,2-7,12-16H2,1H3/t17?,20-,21?,23?,24-/m1/s1 |
| InChIKey | BMNVUFROABYKEN-UGFOSSBDSA-N |
| XLogP | 3.29 |
| TPSA | 126.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.55 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|