C26H36N2O9 — CID 22811985
1-[(2R,3S)-1-(oxan-2-yl)-2-[1-(oxan-2-yloxy)propan-2-yl]-4-oxoazetidin-3-yl]ethyl 2-(4-nitrophenyl)ethaneperoxoate (PubChem CID 22811985) has the molecular formula C26H36N2O9 and a molecular weight of 520.58 g/mol. Its IUPAC name is 1-[(2R,3S)-1-(oxan-2-yl)-2-[1-(oxan-2-yloxy)propan-2-yl]-4-oxoazetidin-3-yl]ethyl 2-(4-nitrophenyl)ethaneperoxoate.
| Compound Name | 1-[(2R,3S)-1-(oxan-2-yl)-2-[1-(oxan-2-yloxy)propan-2-yl]-4-oxoazetidin-3-yl]ethyl 2-(4-nitrophenyl)ethaneperoxoate |
|---|---|
| PubChem CID | 22811985 |
| Molecular Formula | C26H36N2O9 |
| Molecular Weight | 520.58 g/mol |
| Exact Mass | 520.24 |
| IUPAC Name | 1-[(2R,3S)-1-(oxan-2-yl)-2-[1-(oxan-2-yloxy)propan-2-yl]-4-oxoazetidin-3-yl]ethyl 2-(4-nitrophenyl)ethaneperoxoate |
| SMILES | CC(OOC(=O)Cc1ccc([N+](=O)[O-])cc1)[C@H]1C(=O)N(C2CCCCO2)[C@@H]1C(C)COC1CCCCO1 |
| InChI | InChI=1S/C26H36N2O9/c1-17(16-35-23-8-4-6-14-34-23)25-24(26(30)27(25)21-7-3-5-13-33-21)18(2)36-37-22(29)15-19-9-11-20(12-10-19)28(31)32/h9-12,17-18,21,23-25H,3-8,13-16H2,1-2H3/t17?,18?,21?,23?,24-,25-/m1/s1 |
| InChIKey | RGGHVRKJHJJISJ-COFWTEFSSA-N |
| XLogP | 3.53 |
| TPSA | 126.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.58 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|