C14H19N3O4 — CID 90272738
[(1S,2S)-2-[(2-nitrophenyl)methylamino]cyclohexyl]carbamic acid (PubChem CID 90272738) has the molecular formula C14H19N3O4 and a molecular weight of 293.32 g/mol. Its IUPAC name is [(1S,2S)-2-[(2-nitrophenyl)methylamino]cyclohexyl]carbamic acid.
| Compound Name | [(1S,2S)-2-[(2-nitrophenyl)methylamino]cyclohexyl]carbamic acid |
|---|---|
| PubChem CID | 90272738 |
| Molecular Formula | C14H19N3O4 |
| Molecular Weight | 293.32 g/mol |
| Exact Mass | 293.14 |
| IUPAC Name | [(1S,2S)-2-[(2-nitrophenyl)methylamino]cyclohexyl]carbamic acid |
| SMILES | O=C(O)N[C@H]1CCCC[C@@H]1NCc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H19N3O4/c18-14(19)16-12-7-3-2-6-11(12)15-9-10-5-1-4-8-13(10)17(20)21/h1,4-5,8,11-12,15-16H,2-3,6-7,9H2,(H,18,19)/t11-,12-/m0/s1 |
| InChIKey | DCQPSVQZQCGVMX-RYUDHWBXSA-N |
| XLogP | 2.26 |
| TPSA | 104.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.32 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|