C14H17F3N2O2 — CID 43730633
N-[(2-nitrophenyl)methyl]-2-(trifluoromethyl)cyclohexan-1-amine (PubChem CID 43730633) has the molecular formula C14H17F3N2O2 and a molecular weight of 302.30 g/mol. Its IUPAC name is N-[(2-nitrophenyl)methyl]-2-(trifluoromethyl)cyclohexan-1-amine.
| Compound Name | N-[(2-nitrophenyl)methyl]-2-(trifluoromethyl)cyclohexan-1-amine |
|---|---|
| PubChem CID | 43730633 |
| Molecular Formula | C14H17F3N2O2 |
| Molecular Weight | 302.30 g/mol |
| Exact Mass | 302.12 |
| IUPAC Name | N-[(2-nitrophenyl)methyl]-2-(trifluoromethyl)cyclohexan-1-amine |
| SMILES | O=[N+]([O-])c1ccccc1CNC1CCCCC1C(F)(F)F |
| InChI | InChI=1S/C14H17F3N2O2/c15-14(16,17)11-6-2-3-7-12(11)18-9-10-5-1-4-8-13(10)19(20)21/h1,4-5,8,11-12,18H,2-3,6-7,9H2 |
| InChIKey | HMKAHKCDDNPDJT-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 55.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.30 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|