C15H16F3N3O3 — CID 119043768
N-[(5-nitro-1,3-benzoxazol-2-yl)methyl]-2-(trifluoromethyl)cyclohexan-1-amine (PubChem CID 119043768) has the molecular formula C15H16F3N3O3 and a molecular weight of 343.31 g/mol. Its IUPAC name is N-[(5-nitro-1,3-benzoxazol-2-yl)methyl]-2-(trifluoromethyl)cyclohexan-1-amine.
| Compound Name | N-[(5-nitro-1,3-benzoxazol-2-yl)methyl]-2-(trifluoromethyl)cyclohexan-1-amine |
|---|---|
| PubChem CID | 119043768 |
| Molecular Formula | C15H16F3N3O3 |
| Molecular Weight | 343.31 g/mol |
| Exact Mass | 343.11 |
| IUPAC Name | N-[(5-nitro-1,3-benzoxazol-2-yl)methyl]-2-(trifluoromethyl)cyclohexan-1-amine |
| SMILES | O=[N+]([O-])c1ccc2oc(CNC3CCCCC3C(F)(F)F)nc2c1 |
| InChI | InChI=1S/C15H16F3N3O3/c16-15(17,18)10-3-1-2-4-11(10)19-8-14-20-12-7-9(21(22)23)5-6-13(12)24-14/h5-7,10-11,19H,1-4,8H2 |
| InChIKey | RWUSNRXKSNUGNO-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 81.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.31 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|