C14H17N3O4 — CID 111913109
[1-[(5-nitro-1,3-benzoxazol-2-yl)methyl]piperidin-4-yl]methanol (PubChem CID 111913109) has the molecular formula C14H17N3O4 and a molecular weight of 291.31 g/mol. Its IUPAC name is [1-[(5-nitro-1,3-benzoxazol-2-yl)methyl]piperidin-4-yl]methanol.
| Compound Name | [1-[(5-nitro-1,3-benzoxazol-2-yl)methyl]piperidin-4-yl]methanol |
|---|---|
| PubChem CID | 111913109 |
| Molecular Formula | C14H17N3O4 |
| Molecular Weight | 291.31 g/mol |
| Exact Mass | 291.12 |
| IUPAC Name | [1-[(5-nitro-1,3-benzoxazol-2-yl)methyl]piperidin-4-yl]methanol |
| SMILES | O=[N+]([O-])c1ccc2oc(CN3CCC(CO)CC3)nc2c1 |
| InChI | InChI=1S/C14H17N3O4/c18-9-10-3-5-16(6-4-10)8-14-15-12-7-11(17(19)20)1-2-13(12)21-14/h1-2,7,10,18H,3-6,8-9H2 |
| InChIKey | JHSPDPNSFJPISL-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 92.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.31 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|