C14H17N3O4S — CID 96830789
(1S,2S,3R)-2,3-dimethyl-4-[(5-nitro-1,3-benzoxazol-2-yl)methyl]-1,4-thiazinane 1-oxide (PubChem CID 96830789) has the molecular formula C14H17N3O4S and a molecular weight of 323.37 g/mol. Its IUPAC name is (1S,2S,3R)-2,3-dimethyl-4-[(5-nitro-1,3-benzoxazol-2-yl)methyl]-1,4-thiazinane 1-oxide.
| Compound Name | (1S,2S,3R)-2,3-dimethyl-4-[(5-nitro-1,3-benzoxazol-2-yl)methyl]-1,4-thiazinane 1-oxide |
|---|---|
| PubChem CID | 96830789 |
| Molecular Formula | C14H17N3O4S |
| Molecular Weight | 323.37 g/mol |
| Exact Mass | 323.09 |
| IUPAC Name | (1S,2S,3R)-2,3-dimethyl-4-[(5-nitro-1,3-benzoxazol-2-yl)methyl]-1,4-thiazinane 1-oxide |
| SMILES | C[C@@H]1[C@H](C)[S@@](=O)CCN1Cc1nc2cc([N+](=O)[O-])ccc2o1 |
| InChI | InChI=1S/C14H17N3O4S/c1-9-10(2)22(20)6-5-16(9)8-14-15-12-7-11(17(18)19)3-4-13(12)21-14/h3-4,7,9-10H,5-6,8H2,1-2H3/t9-,10+,22+/m1/s1 |
| InChIKey | SBRVSJGYLZOJCI-BNMUBRSASA-N |
| XLogP | 2.08 |
| TPSA | 89.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.37 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|