C17H16N4O5 — CID 19813428
N-methyl-N-[(5-nitro-1,3-benzoxazol-2-yl)methyl]-2-(4-nitrophenyl)ethanamine (PubChem CID 19813428) has the molecular formula C17H16N4O5 and a molecular weight of 356.34 g/mol. Its IUPAC name is N-methyl-N-[(5-nitro-1,3-benzoxazol-2-yl)methyl]-2-(4-nitrophenyl)ethanamine.
| Compound Name | N-methyl-N-[(5-nitro-1,3-benzoxazol-2-yl)methyl]-2-(4-nitrophenyl)ethanamine |
|---|---|
| PubChem CID | 19813428 |
| Molecular Formula | C17H16N4O5 |
| Molecular Weight | 356.34 g/mol |
| Exact Mass | 356.11 |
| IUPAC Name | N-methyl-N-[(5-nitro-1,3-benzoxazol-2-yl)methyl]-2-(4-nitrophenyl)ethanamine |
| SMILES | CN(CCc1ccc([N+](=O)[O-])cc1)Cc1nc2cc([N+](=O)[O-])ccc2o1 |
| InChI | InChI=1S/C17H16N4O5/c1-19(9-8-12-2-4-13(5-3-12)20(22)23)11-17-18-15-10-14(21(24)25)6-7-16(15)26-17/h2-7,10H,8-9,11H2,1H3 |
| InChIKey | QYFHKUGJAQWSGZ-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 115.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.34 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|