C18H18ClN3O3 — CID 87022267
3-(1,3-benzoxazol-2-yl)-N-[(2-chloro-5-nitrophenyl)methyl]-N-methylpropan-1-amine (PubChem CID 87022267) has the molecular formula C18H18ClN3O3 and a molecular weight of 359.81 g/mol. Its IUPAC name is 3-(1,3-benzoxazol-2-yl)-N-[(2-chloro-5-nitrophenyl)methyl]-N-methylpropan-1-amine.
| Compound Name | 3-(1,3-benzoxazol-2-yl)-N-[(2-chloro-5-nitrophenyl)methyl]-N-methylpropan-1-amine |
|---|---|
| PubChem CID | 87022267 |
| Molecular Formula | C18H18ClN3O3 |
| Molecular Weight | 359.81 g/mol |
| Exact Mass | 359.10 |
| IUPAC Name | 3-(1,3-benzoxazol-2-yl)-N-[(2-chloro-5-nitrophenyl)methyl]-N-methylpropan-1-amine |
| SMILES | CN(CCCc1nc2ccccc2o1)Cc1cc([N+](=O)[O-])ccc1Cl |
| InChI | InChI=1S/C18H18ClN3O3/c1-21(12-13-11-14(22(23)24)8-9-15(13)19)10-4-7-18-20-16-5-2-3-6-17(16)25-18/h2-3,5-6,8-9,11H,4,7,10,12H2,1H3 |
| InChIKey | POPQDHLRWVWEBT-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 72.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.81 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|